CymitQuimica logo

CAS 62810-32-6

:

Propanoic acid, 2-[3-[(4-chlorophenyl)methyl]phenoxy]-2-methyl-

Description:
Propanoic acid, 2-[3-[(4-chlorophenyl)methyl]phenoxy]-2-methyl- is an organic compound characterized by its propanoic acid backbone, which features a phenoxy group and a chlorophenyl substituent. This compound typically exhibits properties associated with carboxylic acids, such as acidity due to the presence of the carboxyl functional group (-COOH). The presence of the phenoxy group suggests potential for hydrogen bonding and increased lipophilicity, which can influence its solubility in organic solvents. The chlorophenyl moiety may impart additional biological activity or reactivity, often enhancing the compound's interaction with biological systems. The molecular structure indicates that it may have applications in pharmaceuticals or agrochemicals, given the presence of functional groups that can participate in various chemical reactions. Overall, this compound is likely to exhibit moderate to high stability under standard conditions, with potential reactivity towards nucleophiles or electrophiles due to the functional groups present.
Formula:C17H17ClO3
InChI:InChI=1S/C17H17ClO3/c1-17(2,16(19)20)21-15-5-3-4-13(11-15)10-12-6-8-14(18)9-7-12/h3-9,11H,10H2,1-2H3,(H,19,20)
InChI key:NHVJRAUOXTZHNX-UHFFFAOYSA-N
SMILES:CC(C)(C(=O)O)OC1=CC=CC(=C1)CC2=CC=C(C=C2)Cl
Found 1 products.