CymitQuimica logo

CAS 62825-88-1

:

5-(2-chlorobenzyl)-1,3-oxazolidin-2-one

Description:
5-(2-Chlorobenzyl)-1,3-oxazolidin-2-one is a chemical compound characterized by its oxazolidinone structure, which features a five-membered ring containing both nitrogen and oxygen atoms. The presence of the 2-chlorobenzyl group contributes to its unique properties, including potential biological activity. This compound is typically a white to off-white solid and is soluble in organic solvents, reflecting its moderate polarity. It may exhibit various pharmacological activities, making it of interest in medicinal chemistry, particularly in the development of antibiotics and other therapeutic agents. The oxazolidinone core is known for its role in inhibiting bacterial protein synthesis, which is a key mechanism in combating bacterial infections. Additionally, the chlorine substituent can influence the compound's reactivity and interaction with biological targets. As with many chemical substances, safety and handling precautions are essential, as it may pose health risks if not managed properly. Overall, 5-(2-chlorobenzyl)-1,3-oxazolidin-2-one represents a significant compound in the field of organic and medicinal chemistry.
Formula:C10H10ClNO2
InChI:InChI=1/C10H10ClNO2/c11-9-4-2-1-3-7(9)5-8-6-12-10(13)14-8/h1-4,8H,5-6H2,(H,12,13)
InChI key:PCOMYIUSMUMECB-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)CC1CN=C(O)O1)Cl
Found 1 products.