CymitQuimica logo

CAS 628297-55-2

:

3-(1-methyl-1H-pyrazol-5-yl)benzoic acid

Description:
3-(1-Methyl-1H-pyrazol-5-yl)benzoic acid, with the CAS number 628297-55-2, is an organic compound characterized by its pyrazole and benzoic acid moieties. This compound features a benzoic acid group attached to a pyrazole ring, specifically at the 3-position of the benzene ring. The presence of the methyl group on the pyrazole enhances its lipophilicity and may influence its biological activity. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic aromatic structure. The carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect its reactivity and interactions with other molecules. Such compounds are often investigated for their pharmacological properties, including anti-inflammatory and analgesic activities, making them of interest in medicinal chemistry. Overall, the unique structural features of 3-(1-methyl-1H-pyrazol-5-yl)benzoic acid suggest potential applications in various chemical and pharmaceutical contexts.
Formula:C11H10N2O2
InChI:InChI=1/C11H10N2O2/c1-13-10(5-6-12-13)8-3-2-4-9(7-8)11(14)15/h2-7H,1H3,(H,14,15)
InChI key:OBOMYSVFLSMYLV-UHFFFAOYSA-N
SMILES:Cn1c(ccn1)c1cccc(c1)C(=O)O
Found 3 products.