CymitQuimica logo

CAS 62833-66-3

:

1H-Pyrrole-1-acetamide, 2,5-dihydro-2-oxo-

Description:
1H-Pyrrole-1-acetamide, 2,5-dihydro-2-oxo- is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic ring containing one nitrogen atom. This compound features an acetamide functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the 2,5-dihydro-2-oxo moiety indicates that it has a carbonyl group (C=O) adjacent to the nitrogen, which can influence its chemical behavior, including hydrogen bonding and reactivity in various chemical reactions. Typically, compounds like this may exhibit biological activity, making them of interest in drug development and synthesis. The molecular structure allows for various interactions, potentially leading to diverse pharmacological effects. Additionally, the compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, 1H-Pyrrole-1-acetamide, 2,5-dihydro-2-oxo- is a compound of interest in organic synthesis and pharmaceutical research due to its unique structural features.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c7-5(9)4-8-3-1-2-6(8)10/h1-2H,3-4H2,(H2,7,9)
InChI key:FPEUENMSBVHCSB-UHFFFAOYSA-N
SMILES:C1C=CC(=O)N1CC(=O)N
Synonyms:
  • oxiracetaM related substance ISF2560
Found 3 products.