CymitQuimica logo

CAS 628330-74-5

:

Benzenemethanol, 3-fluoro-2-(phenylmethoxy)-

Description:
Benzenemethanol, 3-fluoro-2-(phenylmethoxy)-, also known by its CAS number 628330-74-5, is an organic compound characterized by the presence of a benzene ring, a methanol group, and a fluorine atom. This compound features a phenylmethoxy group, which contributes to its overall structure and reactivity. The fluorine substituent at the 3-position of the benzene ring can influence the compound's electronic properties, potentially enhancing its reactivity in various chemical reactions. The presence of the methoxy group can also affect solubility and polarity, making it more soluble in organic solvents. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its synthesis and applications could be explored in various fields, including pharmaceuticals and agrochemicals, where modifications to aromatic compounds are often pursued for enhanced efficacy or specificity. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C14H13FO2
InChI:InChI=1S/C14H13FO2/c15-13-8-4-7-12(9-16)14(13)17-10-11-5-2-1-3-6-11/h1-8,16H,9-10H2
InChI key:YBGUZEDVAZYDAH-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)COC2=C(C=CC=C2F)CO
Synonyms:
  • 2-Benzyloxy-3-fluorobenzyl alcohol
  • Benzenemethanol, 3-fluoro-2-(phenylmethoxy)-
Found 3 products.