CymitQuimica logo

CAS 628332-15-0

:

3(2H)-Pyridazinone, 4,5-dihydro-6-(trifluoromethyl)-

Description:
3(2H)-Pyridazinone, 4,5-dihydro-6-(trifluoromethyl)- is a heterocyclic organic compound characterized by a pyridazinone core structure, which features a six-membered ring containing two nitrogen atoms. This compound is notable for its trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the dihydro group indicates that the compound has two hydrogen atoms added to the ring, contributing to its stability and reactivity. Typically, such compounds may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The trifluoromethyl group can enhance the compound's metabolic stability and alter its interaction with biological targets. Additionally, the compound's CAS number, 628332-15-0, allows for precise identification in chemical databases and literature. Overall, 3(2H)-Pyridazinone, 4,5-dihydro-6-(trifluoromethyl)- represents a class of compounds that may have applications in drug development and other chemical research fields.
Formula:C5H5F3N2O
InChI:InChI=1S/C5H5F3N2O/c6-5(7,8)3-1-2-4(11)10-9-3/h1-2H2,(H,10,11)
InChI key:IJGACGPBDXVCGJ-UHFFFAOYSA-N
SMILES:C1CC(=O)NN=C1C(F)(F)F
Found 4 products.