CymitQuimica logo

CAS 6286-43-7

:

Cyclohexanetriol

Description:
Cyclohexanetriol, with the CAS number 6286-43-7, is a cyclic alcohol characterized by the presence of three hydroxyl (-OH) groups attached to a cyclohexane ring. This compound typically exists as a colorless, viscous liquid or solid, depending on the specific isomer and conditions. The presence of multiple hydroxyl groups imparts significant hydrophilicity, making cyclohexanetriol soluble in water and various organic solvents. Its chemical structure allows for the formation of hydrogen bonds, which can influence its reactivity and interactions with other substances. Cyclohexanetriol is often utilized in various applications, including as a building block in organic synthesis, in the formulation of cosmetics and personal care products, and as a potential plasticizer. Additionally, its properties can vary based on the specific isomer (e.g., 1,2,3-cyclohexanetriol) and the arrangement of hydroxyl groups, which can affect its physical and chemical behavior. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C6H12O3
InChI:InChI=1/C6H12O3/c7-4-2-1-3-5(8)6(4)9/h4-9H,1-3H2
InChI key:IZSANPWSFUSNMY-UHFFFAOYSA-N
SMILES:C1CC(C(C(C1)O)O)O
Synonyms:
  • 1,2,3-Cyclohexanetriol (cis- and trans- mixture)
  • Cyclohexane-1,2,3-Triol
Found 5 products.