CymitQuimica logo

CAS 62872-36-0

:

Acetamide, 2-bromo-2-iodo-

Description:
Acetamide, 2-bromo-2-iodo- is an organic compound characterized by the presence of both bromine and iodine substituents on the carbon adjacent to the amide functional group. This compound features a carbonyl group (C=O) linked to a nitrogen atom (N), which is typical of amides, and is further substituted with a bromo and an iodo group at the second carbon position. The presence of these halogens can significantly influence the compound's reactivity, polarity, and solubility in various solvents. Acetamide derivatives often exhibit interesting biological activities and can serve as intermediates in organic synthesis. The molecular structure suggests potential applications in pharmaceuticals and agrochemicals, where halogenated compounds are frequently utilized for their unique properties. Additionally, the compound's stability and reactivity can be affected by the electronic effects of the halogen substituents, making it a subject of interest in synthetic organic chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C2H3BrINO
InChI:InChI=1S/C2H3BrINO/c3-1(4)2(5)6/h1H,(H2,5,6)
InChI key:XQMKVQDLGURGON-UHFFFAOYSA-N
SMILES:C(C(=O)N)(Br)I
Found 1 products.