
CAS 62874-51-5
:4-Amino-1-[[(carbamoylamino)acetyl]methylamino]-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-β-L-lyxo-heptopyranosyl)-6-O-methyl-L-chiro-inositol
Description:
The chemical substance known as "4-Amino-1-[[(carbamoylamino)acetyl]methylamino]-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-β-L-lyxo-heptopyranosyl)-6-O-methyl-L-chiro-inositol," with the CAS number 62874-51-5, is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as amino, carbamoyl, and methyl groups. This compound features a dideoxy sugar moiety and is linked to a chiro-inositol derivative, indicating potential biological activity, particularly in the context of glycosylation and cellular signaling pathways. Its structural complexity suggests that it may exhibit specific interactions with biological macromolecules, potentially influencing metabolic processes. The presence of amino and carbamoyl groups implies that it may participate in various biochemical reactions, including those related to amino acid metabolism. Due to its unique structure, this compound may have applications in medicinal chemistry or as a biochemical probe, although specific biological activities and therapeutic potentials would require further investigation through empirical studies.
Formula:C18H36N6O7
InChI:InChI=1S/C18H36N6O7/c1-7(19)9-5-4-8(20)17(30-9)31-15-11(21)13(26)16(29-3)12(14(15)27)24(2)10(25)6-23-18(22)28/h7-9,11-17,26-27H,4-6,19-21H2,1-3H3,(H3,22,23,28)/t7-,8+,9-,11-,12-,13-,14+,15+,16+,17+/m0/s1
InChI key:VKGIGFQBOYWLHV-APGVDKLISA-N
SMILES:C[C@@H]([C@@H]1CC[C@H]([C@H](O1)O[C@@H]2[C@H]([C@@H]([C@@H]([C@H]([C@H]2O)N(C)C(=O)CNC(=O)N)OC)O)N)N)N
Synonyms:- L-chiro-Inositol, 4-amino-1-[[2-[(aminocarbonyl)amino]acetyl]methylamino]-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-β-L-lyxo-heptopyranosyl)-6-O-methyl-
- Fortimicin C
- 4-Amino-1-[[(carbamoylamino)acetyl]methylamino]-1,4-dideoxy-3-O-(2,6-diamino-2,3,4,6,7-pentadeoxy-β-L-lyxo-heptopyranosyl)-6-O-methyl-L-chiro-inositol
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Fortimicin C
CAS:Fortimicin C is a bioactive chemical.Formula:C18H36N6O7Color and Shape:SolidMolecular weight:448.521
