
CAS 62880-95-9
:FS SAMSA-6A
Description:
FS SAMSA-6A, with the CAS number 62880-95-9, is a chemical substance that belongs to the category of surfactants, specifically a type of amphoteric surfactant. It is characterized by its ability to function effectively in both acidic and alkaline environments, making it versatile for various applications. FS SAMSA-6A typically exhibits good wetting, emulsifying, and foaming properties, which are essential in formulations for personal care products, detergents, and industrial applications. The substance is often used in formulations due to its mildness and compatibility with other ingredients, enhancing the overall performance of the product. Additionally, it is biodegradable, which aligns with increasing environmental concerns regarding the use of surfactants. Safety data sheets indicate that while it is generally considered safe for use in consumer products, appropriate handling and usage guidelines should be followed to minimize any potential risks. Overall, FS SAMSA-6A is valued for its multifunctional properties and its role in improving the efficacy of various formulations.
Formula:C15H18F13NO4S2
InChI:InChI=1S/C15H18F13NO4S2/c1-9(2,7-35(31,32)33)29-8(30)3-5-34-6-4-10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h3-7H2,1-2H3,(H,29,30)(H,31,32,33)
InChI key:DKVATWZCDNHYCW-UHFFFAOYSA-N
SMILES:CC(C)(CS(=O)(=O)O)NC(=O)CCSCCC(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Methyl-2-[[1-oxo-3-[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)thio]propyl]amino]-1-propanesulfonic acid
CAS:2-Methyl-2-[[1-oxo-3-[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)thio]propyl]amino]-1-propanesulfonic acid
Molecular weight:587.41696g/mol6:2-Fluorotelomer Thioether Amido Sulfonic Acid
CAS:Formula:C15H18F13NO4S2Color and Shape:NeatMolecular weight:587.417



