CymitQuimica logo

CAS 62902-66-3

:

6-(3-Chlorophenyl)-3(2H)-pyridazinone

Description:
6-(3-Chlorophenyl)-3(2H)-pyridazinone, with the CAS number 62902-66-3, is a chemical compound characterized by its pyridazinone core structure, which features a pyridazine ring fused with a carbonyl group. The presence of a 3-chlorophenyl group enhances its chemical properties, potentially influencing its reactivity and biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both aromatic and heterocyclic components that can interact with biological targets. Additionally, the chlorophenyl substituent may impart specific electronic and steric effects, which can be crucial for its activity. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks if ingested or inhaled. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C10H7ClN2O
InChI:InChI=1S/C10H7ClN2O/c11-8-3-1-2-7(6-8)9-4-5-10(14)13-12-9/h1-6H,(H,13,14)
InChI key:InChIKey=YRWWFLYKKZTALE-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1)C=2C=CC(=O)NN2
Synonyms:
  • 6-(3-Chlorophenyl)-2H-pyridazin-3-one
  • 3(2H)-Pyridazinone, 6-(3-chlorophenyl)-
  • 6-(3-Chlorophenyl)-3(2H)-pyridazinone
Found 4 products.