CAS 62903-07-5

3-Bromo-4-methyl-γ-oxobenzenebutanoic acid

Description:

3-Bromo-4-methyl-γ-oxobenzenebutanoic acid, with the CAS number 62903-07-5, is an organic compound characterized by its unique structure that includes a bromine atom, a methyl group, and a γ-oxobenzenebutanoic acid moiety. This compound features a benzene ring substituted with a bromine atom at the 3-position and a methyl group at the 4-position, contributing to its reactivity and potential applications in organic synthesis. The presence of the γ-oxo group indicates that it has a ketone functional group adjacent to the carboxylic acid, which can influence its acidity and reactivity. This compound may exhibit properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry and material science. Its synthesis and characterization would typically involve standard organic reactions, and it may serve as an intermediate in the production of pharmaceuticals or agrochemicals. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts.

Formula: C₁₁H₁₁BrO₃

InChI: InChI=1S/C11H11BrO3/c1-7-2-3-8(6-9(7)12)10(13)4-5-11(14)15/h2-3,6H,4-5H2,1H3,(H,14,15)

InChI key: InChIKey=NXOCYNUARNHLTD-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)(=O)C1=CC(Br)=C(C)C=C1

Synonyms:

• Benzenebutanoic acid, 3-bromo-4-methyl-γ-oxo-
• 3-Bromo-4-methyl-γ-oxobenzenebutanoic acid

4-(3-Bromo-4-methylphenyl)-4-oxobutyric acid

CAS: 62903-07-5

Formula: C₁₁H₁₁BrO₃

Purity: 97%

Molecular weight: 271.11

Ref: 10-F207296