CymitQuimica logo

CAS 62908-83-2

:

3-methyl-5-nitro-1H-pyrazolo[3,4-b]pyridine

Description:
3-Methyl-5-nitro-1H-pyrazolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. This compound features a methyl group at the 3-position and a nitro group at the 5-position of the pyrazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the nitro group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and reductions. Additionally, compounds of this class may exhibit biological activity, which can be of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, making it a subject of research in drug development. Safety data should be consulted for handling, as nitro compounds can be sensitive and may pose health risks. Overall, 3-methyl-5-nitro-1H-pyrazolo[3,4-b]pyridine is a compound of interest in both synthetic and medicinal chemistry.
Formula:C7H6N4O2
InChI:InChI=1/C7H6N4O2/c1-4-6-2-5(11(12)13)3-8-7(6)10-9-4/h2-3H,1H3,(H,8,9,10)
InChI key:VHUAFDKORZHXOD-UHFFFAOYSA-N
SMILES:Cc1c2cc(cnc2n[nH]1)N(=O)=O
Synonyms:
  • 1H-pyrazolo[3,4-b]pyridine, 3-methyl-5-nitro-
  • 3-Methyl-5-nitro-1H-pyrazolo[3,4-b]pyridine
Found 4 products.