CAS 62956-48-3

Gomisin G

Description:

Gomisin G is a natural compound classified as a lignan, primarily derived from the fruit of the Schisandra chinensis plant, commonly known as magnolia berry or five-flavor fruit. It is known for its potential pharmacological properties, including antioxidant, anti-inflammatory, and hepatoprotective effects. Gomisin G exhibits a complex molecular structure that contributes to its biological activity, and it is often studied for its role in traditional medicine and potential therapeutic applications. The compound has garnered interest in the field of natural product chemistry due to its diverse effects on human health, particularly in relation to liver function and metabolic processes. Additionally, Gomisin G may interact with various biological pathways, making it a subject of research in pharmacology and toxicology. Its safety profile and efficacy in clinical settings are still under investigation, highlighting the need for further studies to fully understand its potential benefits and mechanisms of action.

Formula: C₃₀H₃₂O₉

InChI: InChI=1S/C30H32O9/c1-16-12-18-13-20(33-3)24(34-4)26(35-5)22(18)23-19(14-21-25(27(23)36-6)38-15-37-21)28(30(16,2)32)39-29(31)17-10-8-7-9-11-17/h7-11,13-14,16,28,32H,12,15H2,1-6H3/t16-,28-,30-/m0/s1

InChI key: OFDWKHIQKPKRKY-DSASHONVSA-N

SMILES: C[C@H]1CC2=CC(=C(C(=C2C3=C(C4=C(C=C3[C@@H]([C@@]1(C)O)OC(=O)C5=CC=CC=C5)OCO4)OC)OC)OC)OC

Gomisin G

CAS: 62956-48-3

Gomisin G

Formula: C₃₀H₃₂O₉

Purity: 99.5%

Molecular weight: 536.57

Ref: 54-BUP01431

Gomisin G

CAS: 62956-48-3

Formula: C₃₀H₃₂O₉

Molecular weight: 536.58

Ref: 7W-GY2525

Gomisin G

CAS: 62956-48-3

Formula: C₃₀H₃₂O₉

Purity: 99%

Color and Shape: Solid

Molecular weight: 536.5697

Ref: IN-DA00ECFE

Gomisin G

CAS: 62956-48-3

Formula: C₃₀H₃₂O₉

Purity: 95%~99%

Molecular weight: 536.577

Ref: BP-BP0684

Gomisin G

CAS: 62956-48-3

Gomisin G is a natural compound and exhibits potent anti-HIV activity (EC50: 0.006 μg/mL; therapeutic index: 300). It is a good substrate of CYP2C9.

Formula: C₃₀H₃₂O₉

Purity: 99.95% - 99.98%

Color and Shape: Solid

Molecular weight: 536.5697

Ref: TM-TQ0217

Gomisin G

CAS: 62956-48-3

Carboxylic acid with additional oxygen functions

Formula: C₃₀H₃₂O₉

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 536.58

Ref: 5G-83314

Gomisin G

Controlled Product

CAS: 62956-48-3

Gomisin G is a drug that inhibits the activity of the enzyme epidermal growth factor receptor. It has been shown to inhibit the activities of other enzymes, such as hydroxyl group-containing enzymes and protein kinase C. The natural compound gomisin G has been shown to inhibit drug transporter proteins, including P-glycoprotein, in vitro. Gomisin G has also been shown to bind to and inhibit human cyp3a4. This inhibition may be responsible for the observed interactions with pentobarbital sodium and other drugs which are substrates for this protein.

Formula: C₃₀H₃₂O₉

Purity: Min. 98 Area-%

Color and Shape: Powder

Molecular weight: 536.57 g/mol

Ref: 3D-FG73871

Gomisin G

CAS: 62956-48-3

Formula: C₃₀H₃₂O₉

Molecular weight: 536.6

Ref: BE-RMT11915

Gomisin G (Standard)

CAS: 62956-48-3

Gomisin G (Standard) is a reference standard for research and analysis in studies involving Gomisin G. Gomisin G is a natural compound and exhibits potent anti-HIV activity (EC₅₀: 0.006 μg/mL; therapeutic index: 300). It is a good substrate of CYP2C9.

Formula: C₃₀H₃₂O₉

Molecular weight: 536.5697

Ref: TM-TMSM-1669