CymitQuimica logo

CAS 6296-41-9

:

3-(4-aminophenyl)-2-oxopropanoic acid

Description:
3-(4-Aminophenyl)-2-oxopropanoic acid, also known by its CAS number 6296-41-9, is an organic compound characterized by its structure, which includes an amino group and a ketone functional group. This compound features a propanoic acid backbone with a phenyl ring substituted at the para position with an amino group, contributing to its potential biological activity. It is typically a white to off-white solid at room temperature and is soluble in polar solvents, such as water and alcohols, due to the presence of the carboxylic acid group. The compound may exhibit properties such as being a potential intermediate in organic synthesis or a building block in pharmaceuticals, particularly in the development of drugs targeting various biological pathways. Its reactivity can be influenced by the amino group, which can participate in various chemical reactions, including acylation and coupling reactions. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks if ingested or inhaled.
Formula:C9H9NO3
InChI:InChI=1/C9H9NO3/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4H,5,10H2,(H,12,13)
InChI key:RVHSKFOBSJSYEH-UHFFFAOYSA-N
SMILES:c1cc(ccc1CC(=O)C(=O)O)N
Synonyms:
  • Benzenepropanoic Acid, 4-Amino-Alpha-Oxo-
  • 3-(4-Aminophenyl)-2-oxopropanoic acid
Found 3 products.