CAS 62965-10-0
:CBZ-L-tert-leucine
Description:
CBZ-L-tert-leucine, also known as carbobenzyloxy-L-tert-leucine, is a protected form of the amino acid leucine, commonly used in peptide synthesis. It features a carbobenzyloxy (CBZ) group, which serves as a protective group for the amino functionality, allowing for selective reactions without interference from the amine. The tert-butyl group in its structure enhances the steric hindrance, making it useful in various synthetic applications. This compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and dimethyl sulfoxide, but less soluble in water. Its stability under standard laboratory conditions makes it a valuable intermediate in organic synthesis, particularly in the preparation of peptides and other bioactive compounds. Additionally, CBZ-L-tert-leucine can be utilized in the development of pharmaceuticals and in research settings for studying protein interactions and functions. Proper handling and storage are essential, as with many chemical substances, to ensure safety and maintain its integrity for experimental use.
Formula:C14H19NO4
InChI:InChI=1/C14H19NO4/c1-14(2,3)11(12(16)17)15-13(18)19-9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3,(H,15,18)(H,16,17)/t11-/m1/s1
SMILES:CC(C)(C)[C@@H](C(=O)O)N=C(O)OCc1ccccc1
Synonyms:- L-valine, 3-methyl-N-[(phenylmethoxy)carbonyl]-
- N-[(Benzyloxy)carbonyl]-3-methyl-L-valine
- Z-Tle-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(S)-2-(((Benzyloxy)carbonyl)amino)-3,3-dimethylbutanoic acid
CAS:Formula:C14H19NO4Purity:95%Color and Shape:SolidMolecular weight:265.3050Cbz-L-tert-Leucine
CAS:Formula:C14H19NO4Purity:97%Color and Shape:Liquid, OilMolecular weight:265.309Cbz-L-tert-Leucine
CAS:Controlled ProductApplications Leucine derivative used in the preparation of various pharmaceutical agents such as TRPV4 antagonists, HIV-1 protease inhibitors and serine protease inhibitors.
References Perni, R.B. et al.: Bioorg. Med. Chem. Lett., 17, 3406 (2007); Ekegren, J.K. et al.: J. Med. Chem., 48, 8098 (2005);Formula:C14H19NO4Color and Shape:NeatMolecular weight:265.3N-Benzyloxycarbonyl-tert-leucine
CAS:N-Benzyloxycarbonyl-tert-leucine is a valuable organic compound for life sciences research (catalog number: T66098, CAS number: 62965-10-0).Formula:C14H19NO4Color and Shape:SolidMolecular weight:265.309




