CymitQuimica logo

CAS 62969-85-1

:

2(1H)-Pyridinone, 6-(1-methylethyl)-

Description:
2(1H)-Pyridinone, 6-(1-methylethyl)-, also known by its CAS number 62969-85-1, is an organic compound characterized by a pyridinone ring structure with an isopropyl group at the 6-position. This compound features a nitrogen atom within a six-membered aromatic ring, contributing to its basicity and potential for hydrogen bonding. The presence of the isopropyl group enhances its hydrophobic characteristics, influencing its solubility and reactivity. Typically, pyridinones exhibit biological activity, making them of interest in medicinal chemistry and drug development. The compound may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, due to the electron-rich nature of the nitrogen atom. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, 2(1H)-Pyridinone, 6-(1-methylethyl)- is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C8H11NO
InChI:InChI=1S/C8H11NO/c1-6(2)7-4-3-5-8(10)9-7/h3-6H,1-2H3,(H,9,10)
InChI key:XNDNTUOEUNAQAX-UHFFFAOYSA-N
SMILES:CC(C)C1=CC=CC(=O)N1
Found 2 products.