CymitQuimica logo

CAS 62980-03-4

:

3-(trifluoromethyl)benzenecarboximidamide hydrochloride

Description:
3-(Trifluoromethyl)benzenecarboximidamide hydrochloride is a chemical compound characterized by its unique structure, which includes a trifluoromethyl group attached to a benzene ring, along with a carboximidamide functional group. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and methanol, due to the presence of the hydrochloride salt form. The trifluoromethyl group contributes to its lipophilicity and can influence its biological activity, making it of interest in pharmaceutical research. The compound may exhibit various properties, including potential antimicrobial or antitumor activities, although specific biological effects would depend on further studies. Its hydrochloride form enhances stability and solubility, making it easier to handle in laboratory settings. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled. Proper storage conditions are also essential to maintain its integrity and prevent degradation.
Formula:C8H8ClF3N2
InChI:InChI=1/C8H7F3N2.ClH/c9-8(10,11)6-3-1-2-5(4-6)7(12)13;/h1-4H,(H3,12,13);1H
InChI key:JRWQLKZLTWPEBO-UHFFFAOYSA-N
SMILES:c1cc(cc(c1)C(F)(F)F)C(=N)N.Cl
Synonyms:
  • 3-(Trifluormethyl)benzolcarboximidamidhydrochlorid(1:1)
  • 3-(Trifluoromethyl)benzenecarboximidamide hydrochloride (1:1)
  • 3-Trifluoromethyl-benzamidine HCl
  • Benzenecarboximidamide, 3-(Trifluoromethyl)-, Hydrochloride (1:1)
  • 3-(Trifluoromethyl)benzenecarboximidamide hydrochloride
Found 4 products.