CymitQuimica logo

CAS 62993-85-5

:

Thiazolium, 3,4,5-trimethyl-, iodide

Description:
Thiazolium, 3,4,5-trimethyl-, iodide is a quaternary ammonium salt characterized by its thiazolium ring structure, which is a five-membered heterocyclic compound containing both sulfur and nitrogen atoms. The presence of three methyl groups at the 3, 4, and 5 positions of the thiazolium ring enhances its lipophilicity and stability, making it useful in various chemical applications. As an iodide salt, it typically exists as a stable crystalline solid, and its iodide component contributes to its ionic character. This compound is often utilized in organic synthesis, particularly in reactions involving nucleophiles and electrophiles, due to its ability to stabilize reactive intermediates. Additionally, thiazolium salts are known for their role as catalysts in various chemical transformations, including those in the field of medicinal chemistry. Its properties, such as solubility in polar solvents and reactivity with various functional groups, make it a valuable compound in both academic research and industrial applications.
Formula:C6H10NS・I
InChI:InChI=1S/C6H10NS.HI/c1-5-6(2)8-4-7(5)3;/h4H,1-3H3;1H/q+1;/p-1
InChI key:LNQUCPBIRQBSQX-UHFFFAOYSA-M
SMILES:CC1=C(SC=[N+]1C)C.[I-]
Found 5 products.