CymitQuimica logo

CAS 62995-79-3

:

N,2,2,6,6-pentamethylpiperidin-4-amine

Description:
N,2,2,6,6-pentamethylpiperidin-4-amine, with the CAS number 62995-79-3, is an organic compound characterized by its piperidine structure, which features a six-membered ring containing one nitrogen atom. This compound is distinguished by the presence of five methyl groups attached to the piperidine ring, specifically at the 2, 2, 6, and 6 positions, along with an amino group at the 4 position. The presence of these bulky methyl groups contributes to its steric hindrance, influencing its reactivity and solubility properties. Typically, such compounds exhibit basic characteristics due to the amine functional group, allowing them to participate in various chemical reactions, including nucleophilic substitutions. N,2,2,6,6-pentamethylpiperidin-4-amine is often utilized in organic synthesis and may serve as a ligand in coordination chemistry or as a building block in the development of pharmaceuticals and agrochemicals. Its unique structure and properties make it a subject of interest in both academic and industrial research.
Formula:C10H22N2
InChI:InChI=1/C10H22N2/c1-9(2)6-8(11-5)7-10(3,4)12-9/h8,11-12H,6-7H2,1-5H3
InChI key:GMIARZNQLSJFCP-UHFFFAOYSA-N
SMILES:CC1(C)CC(CC(C)(C)N1)NC
Found 4 products.