CAS 6301-02-6

1-Aminohydantoin

Description:

1-Aminohydantoin, with the CAS number 6301-02-6, is an organic compound characterized by its hydantoin structure, which features a five-membered ring containing two carbonyl groups and an amine substituent. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. It exhibits properties such as being a weak base due to the presence of the amino group, which can participate in hydrogen bonding. 1-Aminohydantoin is often studied for its potential biological activities, including its role in pharmaceuticals and as a building block in organic synthesis. Additionally, it can be involved in various chemical reactions, such as condensation and cyclization, leading to the formation of more complex molecules. Its stability under normal conditions and reactivity under specific circumstances make it a compound of interest in both research and industrial contexts.

Formula: C₃H₅N₃O₂

InChI: InChI=1S/C3H5N3O2/c4-6-1-2(7)5-3(6)8/h1,4H2,(H,5,7,8)

InChI key: InChIKey=KVYKDNGUEZRPGJ-UHFFFAOYSA-N

SMILES: O=C1N(N)CC(=O)N1

Synonyms:

• 1-Amino-2,4-imidazolidinedione
• 1-Aminohydantoin
• 2,4-Imidazolidinedione, 1-amino-
• Hydantoin, 1-amino-
• Nsc 44144

1-Amino-imidazolidine-2,4-dione

CAS: 6301-02-6

Applications 1-Amino-imidazolidine-2,4-dione (cas# 6301-02-6) is a useful research chemical.

Formula: C₃H₅N₃O₂

Color and Shape: Neat

Molecular weight: 115.09

Ref: TR-A611738

1-Aminohydantoin

CAS: 6301-02-6

1-Aminohydantoin is an aminohydantoin derivative with the molecular formula CHN. It has a number of industrial uses, including as a raw material for the production of other chemicals, such as acrylamide, N-acetylcysteine and citric acid. 1-Aminohydantoin is also used in medicine to treat chronic bronchitis and infectious diseases. 1-Aminohydantoin inhibits bacterial growth by interfering with DNA synthesis and repair. The drug binds to the enzyme dna polymerase and prevents its activity, thereby inhibiting DNA replication. This drug is not effective against either Gram-negative or acid-fast bacteria. 1-Aminohydantoin can be detected in urine using an analytical method that involves measuring the amount of hydrazine formed after the reaction between 1-aminohydantoin and hydrochloric acid in alkaline media at pH 9.5. A monoclonal antibody can be used

Formula: C₃H₅N₃O₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 115.09 g/mol

Ref: 3D-FA156997

1-Aminohydantoin

CAS: 6301-02-6

Formula: C₃H₅N₃O₂

Molecular weight: 115.09

Ref: ST-EA-CP-N12007