CymitQuimica logo

CAS 6301-02-6

:

1-Aminohydantoin

Description:
1-Aminohydantoin, with the CAS number 6301-02-6, is an organic compound characterized by its hydantoin structure, which features a five-membered ring containing two carbonyl groups and an amine substituent. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. It exhibits properties such as being a weak base due to the presence of the amino group, which can participate in hydrogen bonding. 1-Aminohydantoin is often studied for its potential biological activities, including its role in pharmaceuticals and as a building block in organic synthesis. Additionally, it can be involved in various chemical reactions, such as condensation and cyclization, leading to the formation of more complex molecules. Its stability under normal conditions and reactivity under specific circumstances make it a compound of interest in both research and industrial contexts.
Formula:C3H5N3O2
InChI:InChI=1S/C3H5N3O2/c4-6-1-2(7)5-3(6)8/h1,4H2,(H,5,7,8)
InChI key:InChIKey=KVYKDNGUEZRPGJ-UHFFFAOYSA-N
SMILES:O=C1N(N)CC(=O)N1
Synonyms:
  • 1-Amino-2,4-imidazolidinedione
  • 1-Aminohydantoin
  • 2,4-Imidazolidinedione, 1-amino-
  • Hydantoin, 1-amino-
  • Nsc 44144
Found 2 products.