CAS 630122-37-1
:Urea, N-(4-ethylphenyl)-N'-[4-(4-pyridinyloxy)phenyl]-
Description:
Urea, N-(4-ethylphenyl)-N'-[4-(4-pyridinyloxy)phenyl]- is a synthetic organic compound characterized by its urea functional group, which consists of a carbonyl group (C=O) flanked by two amine groups (NH2). This compound features a complex structure that includes an ethylphenyl moiety and a pyridinyloxyphenyl group, contributing to its potential biological activity and applications in medicinal chemistry. The presence of the pyridine ring may enhance its solubility and interaction with biological targets, making it of interest in drug design. Urea derivatives often exhibit diverse properties, including potential antimicrobial or anticancer activities, depending on their specific substituents. The compound's molecular interactions, stability, and reactivity can be influenced by its functional groups and overall structure. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any potential hazards associated with its use.
Formula:C20H19N3O2
InChI:InChI=1S/C20H19N3O2/c1-2-15-3-5-16(6-4-15)22-20(24)23-17-7-9-18(10-8-17)25-19-11-13-21-14-12-19/h3-14H,2H2,1H3,(H2,22,23,24)
InChI key:UUJSPHQATNSVLQ-UHFFFAOYSA-N
SMILES:CCC1=CC=C(C=C1)NC(=O)NC2=CC=C(C=C2)OC3=CC=NC=C3
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
AFG206
CAS:AFG206 is the novel first-generation type II" FLT3 inhibitor."Formula:C20H19N3O2Color and Shape:SolidMolecular weight:333.38
