CymitQuimica logo

CAS 630125-49-4

:

3-Bromo-5-nitrobenzotrifluoride

Description:
3-Bromo-5-nitrobenzotrifluoride is an organic compound characterized by the presence of a bromine atom, a nitro group, and three fluorine atoms attached to a benzene ring. Its molecular structure features a benzotrifluoride core, which is a benzene ring substituted with three fluorine atoms, along with a bromine atom at the meta position and a nitro group at the para position relative to the bromine. This compound is typically a pale yellow solid and is known for its stability and relatively low volatility. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of both electron-withdrawing groups (the nitro and trifluoromethyl groups) influences its reactivity, making it a useful building block in various chemical reactions. Additionally, due to its halogen and nitro substituents, it may exhibit unique properties such as increased polarity and potential for hydrogen bonding, which can affect its solubility and interaction with other chemical species.
Formula:C7H3BrF3NO2
InChI:InChI=1S/C7H3BrF3NO2/c8-5-1-4(7(9,10)11)2-6(3-5)12(13)14/h1-3H
InChI key:YHTVYRKVFAFVLP-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1[N+](=O)[O-])Br)C(F)(F)F
Synonyms:
  • 3-Bromo-5-(trifluoromethyl)nitrobenzene
  • 5-Bromo-3-(Trifluoromethyl)nitrobenzene
  • 1-Bromo-3-Nitro-5-(Trifluoromethyl)Benzene
Found 7 products.