CymitQuimica logo

CAS 63039-46-3

:

(R)-N-BOC-Propargylglycine

Description:
(R)-N-BOC-Propargylglycine is an amino acid derivative characterized by its unique structure, which includes a propargyl group and a tert-butyloxycarbonyl (BOC) protecting group. This compound is often utilized in organic synthesis and peptide chemistry due to its ability to participate in various reactions, including coupling reactions and click chemistry. The BOC group serves as a protective moiety, allowing for selective reactions at the amino group while stabilizing the compound during synthesis. The propargyl moiety introduces an alkyne functionality, enabling further functionalization and the formation of diverse chemical entities. (R)-N-BOC-Propargylglycine is typically a white to off-white solid and is soluble in common organic solvents. Its chirality, indicated by the (R) configuration, is significant in biological applications, as it can influence the activity and interaction of peptides in biological systems. Overall, this compound is valuable in the fields of medicinal chemistry and biochemistry for the development of novel therapeutics and research applications.
Formula:C10H15NO4
InChI:InChI=1/C10H15NO4/c1-5-6-11(7-8(12)13)9(14)15-10(2,3)4/h1H,6-7H2,2-4H3,(H,12,13)
InChI key:AMKHAJIFPHJYMH-SSDOTTSWSA-N
SMILES:C#CCN(CC(=O)O)C(=O)OC(C)(C)C
Synonyms:
  • (R)-N-tert-Butoxycarbonyl-2-amino-4-pentynoic acid
  • Boc-D-Propargylglycine
  • (2R)-2-[(tert-butoxycarbonyl)amino]pent-4-ynoate
  • (2R)-2-[(tert-butoxycarbonyl)amino]pent-4-ynoic acid
  • N-(tert-butoxycarbonyl)-N-prop-2-yn-1-ylglycine
  • Boc-R-2-amino-4-Pentynoic acid
  • Boc-(R)-2-Propargylglycine
Found 5 products.