CAS 63059-25-6
:2-iodobenzenesulfonic acid
Description:
2-Iodobenzenesulfonic acid is an aromatic sulfonic acid characterized by the presence of both an iodine atom and a sulfonic acid group (-SO3H) attached to a benzene ring. This compound typically appears as a white to light yellow crystalline solid and is soluble in water due to the polar sulfonic acid group. The iodine substituent enhances its reactivity, making it useful in various organic synthesis applications, including electrophilic aromatic substitution reactions. The sulfonic acid group imparts acidic properties, allowing it to act as a proton donor in chemical reactions. Additionally, 2-iodobenzenesulfonic acid can serve as a precursor for the synthesis of other compounds, including pharmaceuticals and agrochemicals. Its CAS number, 63059-25-6, is a unique identifier that facilitates its identification in chemical databases. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled, and appropriate personal protective equipment should be used.
Formula:C6H5IO3S
InChI:InChI=1/C6H5IO3S/c7-5-3-1-2-4-6(5)11(8,9)10/h1-4H,(H,8,9,10)
SMILES:c1ccc(c(c1)I)S(=O)(=O)O
Synonyms:- 2-Iodobenzenesulphonic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Iodobenzenesulphonic acid
CAS:2-Iodobenzenesulphonic acidFormula:C6H5IO3SPurity:97%Color and Shape:PowderMolecular weight:284.07157Benzenesulfonic acid, 2-iodo-
CAS:Formula:C6H5IO3SPurity:98%Color and Shape:SolidMolecular weight:284.07162-Iodobenzenesulfonic Acid
CAS:Formula:C6H5IO3SPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalineMolecular weight:284.072-Iodobenzenesulfonic acid
CAS:Formula:C6H5IO3SPurity:97%Color and Shape:SolidMolecular weight:284.072-Iodobenzenesulfonic acid
CAS:2-Iodobenzenesulfonic acid is a synthetic molecule with a molecular weight of 169.27 g/mol. It is an acidic salt that reacts with nucleophilic substitutions, such as hydroxyl groups and heterocycles. 2-Iodobenzenesulfonic acid has been studied using molecular modeling techniques to identify its pharmacophore and the key features that may be important for binding to the active site of the enzyme. The results of these studies show that the most important features are a sulfonyl group, two hydroxyl groups, and an aromatic ring.
Formula:C6H5IO3SPurity:Min. 95%Color and Shape:Slightly Yellow PowderMolecular weight:284.07 g/mol




