CymitQuimica logo

CAS 6307-87-5

:

Methyl 3-bromo-5-nitrobenzoate

Description:
Methyl 3-bromo-5-nitrobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom and a nitro group, along with a methoxycarbonyl group (the ester functional group). Its molecular formula is C9H8BrN2O4, indicating the presence of carbon, hydrogen, bromine, nitrogen, and oxygen atoms. This compound typically appears as a yellow to brown solid and is soluble in organic solvents such as ethanol and acetone, but less soluble in water due to its hydrophobic aromatic structure. Methyl 3-bromo-5-nitrobenzoate is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals, owing to its reactivity and the presence of multiple functional groups that can undergo further chemical transformations. Additionally, it exhibits properties typical of nitro compounds, such as potential biological activity, making it of interest in medicinal chemistry. Proper handling and safety precautions are essential due to its potential toxicity and reactivity.
Formula:C8H6BrNO4
InChI:InChI=1/C8H6BrNO4/c1-14-8(11)5-2-6(9)4-7(3-5)10(12)13/h2-4H,1H3
InChI key:DDJCZBFPZLYREP-UHFFFAOYSA-N
SMILES:COC(=O)c1cc(cc(c1)N(=O)=O)Br
Synonyms:
  • Benzoic acid, 3-bromo-5-nitro-, methyl ester
Found 4 products.