CymitQuimica logo

CAS 63071-03-4

:

2-Methoxy-6-methyl pyridine

Description:
2-Methoxy-6-methylpyridine is an organic compound belonging to the class of pyridines, characterized by a pyridine ring substituted with a methoxy group and a methyl group. Its molecular formula is C8H9NO, indicating the presence of carbon, hydrogen, nitrogen, and oxygen atoms. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic nature. 2-Methoxy-6-methylpyridine is known for its applications in organic synthesis, particularly as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the methoxy group enhances its reactivity, making it a valuable building block in various chemical reactions. Additionally, it exhibits mild toxicity, necessitating appropriate safety precautions during handling. Overall, 2-Methoxy-6-methylpyridine is a versatile compound with significant relevance in chemical research and industrial applications.
Formula:C7H10N2O
InChI:InChI=1/C7H10N2O/c1-8-6-4-3-5-7(9-6)10-2/h3-5H,1-2H3,(H,8,9)
InChI key:WIMNZMOEBDPZTB-UHFFFAOYSA-N
SMILES:CN=c1cccc([nH]1)OC
Synonyms:
  • 2-Methoxy-6-Methylpyridine
  • 6-methoxy-N-methylpyridin-2-amine
Found 5 products.