CymitQuimica logo

CAS 63071-09-0

:

(3-Methylpyridine-2-yl)methanol

Description:
(3-Methylpyridine-2-yl)methanol, with the CAS number 63071-09-0, is an organic compound characterized by its pyridine ring structure substituted with a methyl group and a hydroxymethyl group. This compound features a pyridine moiety, which is a six-membered aromatic ring containing one nitrogen atom, contributing to its basicity and potential for hydrogen bonding. The presence of the hydroxymethyl group (-CH2OH) enhances its solubility in polar solvents and may influence its reactivity, particularly in nucleophilic substitution reactions. (3-Methylpyridine-2-yl)methanol is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is used in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. The compound's properties, such as boiling point, melting point, and specific reactivity, can vary based on its molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H9NO
InChI:InChI=1/C7H9NO/c1-6-3-2-4-8-7(6)5-9/h2-4,9H,5H2,1H3
InChI key:ACDAPUOXXWLLSC-UHFFFAOYSA-N
SMILES:Cc1cccnc1CO
Synonyms:
  • (3-Methylpyridin-2-Yl)Methanol
Found 5 products.