CAS 63123-42-2
:N-Methoxy-4-phenylpyridinium tetrafluoroborate
Description:
N-Methoxy-4-phenylpyridinium tetrafluoroborate is an organic compound characterized by its pyridinium structure, which includes a methoxy group and a phenyl substituent. This compound typically appears as a white to off-white solid and is known for its stability under standard conditions. It is soluble in polar solvents, making it useful in various chemical reactions, particularly in organic synthesis and electrochemistry. The tetrafluoroborate anion contributes to its ionic nature, enhancing its solubility and reactivity. This compound is often utilized as a reagent in synthetic chemistry, particularly in the formation of cationic intermediates. Its unique structure allows for specific interactions in chemical reactions, making it valuable in the development of new materials and pharmaceuticals. Safety precautions should be observed when handling this compound, as with many organic salts, due to potential irritant properties. Overall, N-Methoxy-4-phenylpyridinium tetrafluoroborate is a versatile compound with applications in both academic and industrial chemistry.
Formula:C12H12NO·BF4
InChI:InChI=1S/C12H12NO.BF4/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;2-1(3,4)5/h2-10H,1H3;/q+1;-1
InChI key:InChIKey=MAORPXVTJYMPHC-UHFFFAOYSA-N
SMILES:O(C)[N+]=1C=CC(=CC1)C2=CC=CC=C2.[B+3]([F-])([F-])([F-])[F-]
Synonyms:- 1-Methoxy-4-phenylpyridin-1-ium; tetrafluoroboranuide
- 1-Methoxy-4-phenylpyridinium tetrafluoroborate
- Borate(1-), tetrafluoro-, 1-methoxy-4-phenylpyridinium
- N-Methoxy-4-phenylpyridinium tetrafluoroborate
- Pyridinium, 1-methoxy-4-phenyl-, tetrafluoroborate(1-)
- Pyridinium, 1-methoxy-4-phenyl-, tetrafluoroborate(1-) (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
