CAS 63139-21-9
:(4-Ethylphenyl)boronic acid
Description:
(4-Ethylphenyl)boronic acid, with the CAS number 63139-21-9, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a para-ethyl-substituted phenyl ring. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents such as ethanol and methanol. It is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, including organic synthesis and medicinal chemistry. The boronic acid moiety allows for participation in Suzuki-Miyaura cross-coupling reactions, facilitating the formation of carbon-carbon bonds. Additionally, (4-Ethylphenyl)boronic acid can act as a ligand in coordination chemistry and is utilized in the development of sensors and drug delivery systems due to its ability to interact with biological molecules. Its stability and reactivity under different conditions make it a versatile compound in both academic research and industrial applications.
Formula:C8H11BO2
InChI:InChI=1S/C8H11BO2/c1-2-7-3-5-8(6-4-7)9(10)11/h3-6,10-11H,2H2,1H3
InChI key:InChIKey=RZCPLOMUUCFPQA-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(CC)C=C1
Synonyms:- (p-Ethylphenyl)boronic acid
- 4-Ethylbenzeneboronic acid
- 4-Ethylphenyl boronic acid
- B-(4-Ethylphenyl)boronic acid
- Benzeneboronic acid, p-ethyl-
- Boronic acid, (4-ethylphenyl)-
- Boronic acid, B-(4-ethylphenyl)-
- P-Ethylphenylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Ethylbenzeneboronic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H11BO2Purity:97%Color and Shape:Powder, White to pale creamMolecular weight:149.984-Ethylbenzeneboronic acid
CAS:4-Ethylbenzeneboronic acidFormula:C8H11BO2Purity:≥95%Color and Shape:SolidMolecular weight:149.98274(4-Ethylphenyl)boronic acid
CAS:Formula:C8H11BO2Purity:98%Color and Shape:SolidMolecular weight:149.98274-Ethylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C8H11BO2Purity:97.0 to 114.0 %Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:149.98(4-Ethylphenyl)boronic acid
CAS:(4-Ethylphenyl)boronic acidFormula:C8H11BO2Purity:98%Molecular weight:149.984-Ethylbenzeneboronic acid
CAS:Formula:C8H11BO2Purity:97%Color and Shape:SolidMolecular weight:149.98






