CymitQuimica logo

CAS 63155-12-4

:

2-Pyrimidineacetic acid, sodium salt (1:1)

Description:
2-Pyrimidineacetic acid, sodium salt (1:1) is a chemical compound characterized by its structure, which includes a pyrimidine ring and an acetic acid moiety. As a sodium salt, it is typically soluble in water, making it useful in various biological and chemical applications. The compound exhibits properties associated with both the pyrimidine and carboxylic acid functional groups, which can influence its reactivity and interactions in biological systems. It may act as a buffering agent or a precursor in synthetic pathways due to its ability to participate in acid-base reactions. Additionally, the presence of the sodium ion can enhance its stability and solubility in aqueous environments. This compound is of interest in pharmaceutical research and biochemistry, particularly in studies involving nucleic acids and enzyme interactions. Overall, 2-Pyrimidineacetic acid, sodium salt is a versatile compound with potential applications in medicinal chemistry and biochemistry.
Formula:C6H6N2O2·Na
InChI:InChI=1S/C6H6N2O2.Na/c9-6(10)4-5-7-2-1-3-8-5;/h1-3H,4H2,(H,9,10);
InChI key:InChIKey=VLMIPPALUFTTOM-UHFFFAOYSA-N
SMILES:C(C(O)=O)C=1N=CC=CN1.[Na]
Synonyms:
  • 2-Pyrimidineacetic acid, sodium salt (1:1)
  • 2-Pyrimidineacetic acid, sodium salt
Found 4 products.