CymitQuimica logo

CAS 6319-40-0

:

3-nitro-4-bromobenzoic acid

Description:
3-Nitro-4-bromobenzoic acid is an aromatic carboxylic acid characterized by the presence of both a nitro group and a bromine atom on the benzene ring. Specifically, the nitro group is located at the meta position (3-position) relative to the carboxylic acid group, while the bromine atom is situated at the para position (4-position). This compound typically appears as a crystalline solid and is known for its moderate solubility in organic solvents and limited solubility in water. It exhibits acidic properties due to the carboxylic acid functional group, which can donate a proton in solution. The presence of the electron-withdrawing nitro and bromine substituents influences its reactivity, making it useful in various chemical syntheses and applications, including as an intermediate in the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific UV-Vis absorption characteristics due to its conjugated system, which can be utilized in analytical chemistry for detection and quantification.
Formula:C7H3BrNO4
InChI:InChI=1/C7H4BrNO4/c8-5-2-1-4(7(10)11)3-6(5)9(12)13/h1-3H,(H,10,11)/p-1
InChI key:RVCTZJVBWNFYRU-UHFFFAOYSA-N
SMILES:c1cc(c(cc1C(=O)[O-])N(=O)=O)Br
Synonyms:
  • 4-Bromo-3-Nitrobenzoic Acid
  • Rarechem Ah Ck 0042
  • 4-Bromo-3-Nitro-Benzoic Acid >97%
  • 4-Bromo-3-Nitrobenzoate
Found 6 products.