CymitQuimica logo

CAS 63237-84-3

:

methyl pyrazolo[1,5-a]pyridine-3-carboxylate

Description:
Methyl pyrazolo[1,5-a]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a methyl ester functional group, which contributes to its reactivity and solubility properties. Typically, it appears as a crystalline solid and is soluble in organic solvents such as ethanol and dichloromethane, while being less soluble in water. The presence of the carboxylate group enhances its potential for various chemical reactions, including esterification and nucleophilic substitutions. Methyl pyrazolo[1,5-a]pyridine-3-carboxylate is of interest in medicinal chemistry due to its potential biological activities, which may include anti-inflammatory or antimicrobial properties. Its structural features allow for modifications that can lead to the development of new pharmaceuticals. As with many heterocycles, it may exhibit unique electronic properties, making it a subject of study in materials science and organic synthesis. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C9H8N2O2
InChI:InChI=1/C9H8N2O2/c1-13-9(12)7-6-10-11-5-3-2-4-8(7)11/h2-6H,1H3
InChI key:VOBULDVRGTTWJY-UHFFFAOYSA-N
SMILES:COC(=O)c1cnn2ccccc12
Synonyms:
  • Pyrazolo[1,5-a]pyridine-3-carboxylic acid, methyl ester
  • Methyl pyrazolo[1,5-a]pyridine-3-carboxylate
Found 4 products.