CAS 6326-79-0
:6-bromoisatin
Description:
6-Bromoisatin is an organic compound that belongs to the class of isatin derivatives, characterized by the presence of a bromine atom at the 6-position of the isatin structure. Its molecular formula is C8H5BrN2O2, indicating it contains carbon, hydrogen, bromine, nitrogen, and oxygen. The compound typically appears as a solid, often with a yellow to brown color, and is known for its role in various chemical reactions and applications in medicinal chemistry. 6-Bromoisatin exhibits notable biological activities, including potential antimicrobial and anticancer properties, making it a subject of interest in pharmaceutical research. The presence of the bromine atom can influence its reactivity and interaction with biological targets. Additionally, 6-bromoisatin can participate in various synthetic transformations, serving as a precursor for the synthesis of more complex molecules. Its solubility characteristics may vary depending on the solvent, and it is generally handled with care due to its potential biological effects.
Formula:C8H4BrNO2
InChI:InChI=1/C8H4BrNO2/c9-4-1-2-5-6(3-4)10-8(12)7(5)11/h1-3H,(H,10,11,12)
SMILES:c1cc2c(cc1Br)NC(=O)C2=O
Synonyms:- 6-Bromoindole-2,3-dione
- 6-bromo-1H-indole-2,3-dione
- Indole-2,3-dione,6-bromo- (8CI)
- Nsc 30748
- 1H-Indole-2,3-dione,6-bromo-
- 6-Bromo-2,3-Indolinedione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
6-Bromoisatin
CAS:Formula:C8H4BrNO2Purity:>97.0%(GC)(T)Color and Shape:Light yellow to Brown powder to crystalMolecular weight:226.036-Bromoisatin
CAS:6-BromoisatinFormula:C8H4BrNO2Purity:98%Color and Shape:Solid-PowderMolecular weight:226.026866-Bromoisatin
CAS:Formula:C8H4BrNO2Purity:(HPLC) ≥ 98.0%Color and Shape:Yellow to orange powderMolecular weight:226.036-Bromoisatin
CAS:Formula:C8H4BrNO2Purity:95%Color and Shape:Crystalline PowderMolecular weight:226.0296-Bromoisatin
CAS:6-Bromoisatin is an antimicrobial agent that belongs to the group of ethylene diamines. It has been shown to be a potent inhibitor of cancer cell viability in vivo and can be used as a potential chemotherapy agent. 6-Bromoisatin is active against human pathogens, such as Staphylococcus aureus and Streptococcus pyogenes. This compound has also been shown to inhibit the growth of LPS-stimulated RAW264.7 macrophages, which are used in vitro for studying innate immunity. The mechanism of action involves inhibition of cyclic AMP production, which leads to cell death in cancer cells. 6-Bromoisatin also inhibits the proliferation and viability of granulosa cells and carcinoma cells, with IC50 values in the range of 0.5 - 2 µM.END>>Formula:C8H4BrNO2Purity:Min. 95%Color and Shape:Yellow PowderMolecular weight:226.03 g/mol






