CymitQuimica logo

CAS 6327-87-3

:

1,3-di(pyridin-3-yl)propane-1,3-dione

Description:
1,3-Di(pyridin-3-yl)propane-1,3-dione, with the CAS number 6327-87-3, is an organic compound characterized by its structure, which features two pyridine rings attached to a propane backbone that contains two ketone functional groups. This compound typically exhibits a yellow to orange color in solid form and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic nature. It is known for its potential applications in coordination chemistry, as it can act as a bidentate ligand, forming complexes with various metal ions. The presence of the pyridine rings contributes to its aromaticity and may influence its reactivity and stability. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its synthesis often involves the condensation of appropriate pyridine derivatives with diketones, and it can be characterized using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity.
Formula:C13H10N2O2
InChI:InChI=1/C13H10N2O2/c16-12(10-3-1-5-14-8-10)7-13(17)11-4-2-6-15-9-11/h1-6,8-9H,7H2
SMILES:c1cc(cnc1)C(=O)CC(=O)c1cccnc1
Synonyms:
  • 1,3-Dipyridin-3-Ylpropane-1,3-Dione
Found 1 products.