CAS 633-35-2: Androsta-1,4,6-triene-3,17-dione
Description:Androsta-1,4,6-triene-3,17-dione, commonly known as androstenedione, is a steroid hormone and a precursor in the biosynthesis of androgens and estrogens. It is characterized by its molecular formula C19H24O2 and a structure that includes a steroid backbone with specific double bonds and ketone functional groups. This compound is typically found in the adrenal glands and gonads of both males and females, playing a crucial role in the regulation of various physiological processes, including muscle growth and sexual development. Androstenedione is often studied for its potential effects on athletic performance and its role in hormone replacement therapies. It is important to note that the use of androstenedione as a dietary supplement has been controversial due to its classification as a controlled substance in many sports organizations. Additionally, its synthesis and metabolism in the body can lead to the production of other hormones, such as testosterone and estrone, highlighting its significance in endocrine function.
Formula:C19H22O2
InChI:InChI=1S/C19H22O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h3-4,7,9,11,14-16H,5-6,8,10H2,1-2H3/t14-,15-,16-,18-,19-/m0/s1
InChI key:InChIKey=DKVSUQWCZQBWCP-QAGGRKNESA-N
SMILES:O=C1C=CC2(C(C=CC3C2CCC4(C(=O)CCC34)C)=C1)C
- Synonyms:
- 1,4,6-Androstatrien-3,17-dione
- ATD
- Androstatrienedione
- Δ<sup>1,4,6</sup>-Androstriene-3,17-dione
- Androsta-1,4,6-triene-3,17-dione
- Δ1,4,6-Androstriene-3,17-dione
Androsta-1,4,6- Triene-3,17-Dione
Controlled ProductRef: TR-A637530
| 10mg | 201.00 € | ||
| 25mg | 249.00 € | ||
| 50mg | 446.00 € |
Androsta-1,4,6-triene-3,17-dione
Controlled ProductRef: 3D-FA17906
| 5mg | 243.00 € | ||
| 10mg | 378.00 € |
Androsta-1,4,6-triene-3,17-dione (1.0mg/mL in MeOH)
Controlled ProductRef: TR-KIT8910
| 10x1ml | 326.00 € |
