CAS 6336-45-4
:dibutyl ethenylboronate
Description:
Dibutyl ethenylboronate, with the CAS number 6336-45-4, is an organoboron compound characterized by the presence of a boronate functional group attached to a vinyl group and two butyl groups. This compound typically appears as a colorless to pale yellow liquid and is known for its reactivity in various organic synthesis applications, particularly in the formation of carbon-carbon bonds through cross-coupling reactions. Its structure allows for the participation in reactions such as the Suzuki-Miyaura coupling, making it valuable in the synthesis of complex organic molecules, including pharmaceuticals and agrochemicals. Dibutyl ethenylboronate is generally stable under standard conditions but should be handled with care due to its potential reactivity with moisture and air, which can lead to hydrolysis and the formation of boronic acids. As with many organoboron compounds, it is important to consider safety data and proper handling procedures when working with this substance in a laboratory setting.
Formula:C10H21BO2
InChI:InChI=1/C10H21BO2/c1-4-7-9-12-11(6-3)13-10-8-5-2/h6H,3-5,7-10H2,1-2H3
SMILES:CCCCOB(C=C)OCCCC
Synonyms:- boronic acid, B-ethenyl-, dibutyl ester
- Boronic acid, ethenyl-, dibutyl ester
- Dibutoxyvinylborane
- Dibutyl vinylboronate
- Etheneboronic acid, dibutyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Dibutyl Vinylboronate (stabilized with Phenothiazine)
CAS:Formula:C10H21BO2Purity:>94.0%(GC)Color and Shape:Colorless to Almost colorless clear liquidMolecular weight:184.09Vinylboronic acid dibutyl ester
CAS:Vinylboronic acid dibutyl esterFormula:C10H21BO2Purity:95%Color and Shape:Pale yellow LiquidMolecular weight:184.08354Vinylboronic Acid Dibutyl Ester
CAS:Formula:C10H21BO2Purity:95%Color and Shape:LiquidMolecular weight:184.0835Dibutyl Vinylboronate
CAS:Dibutyl VinylboronateFormula:C10H21BO2Purity:96% +(GC)(stabilized with Phenothiazine)Molecular weight:184.08




