CAS 63407-54-5
:2-phenylethyl 1-thio-beta-D-galactopyranoside
Description:
2-Phenylethyl 1-thio-beta-D-galactopyranoside is a glycoside compound characterized by the presence of a phenylethyl group attached to a galactopyranoside moiety via a thioether linkage. This compound features a beta configuration at the anomeric carbon, which influences its reactivity and biological interactions. The thioether bond imparts unique chemical properties, making it more stable than typical glycosidic bonds. It is often studied for its potential biological activities, including its role in carbohydrate recognition and interactions with lectins. The presence of the phenylethyl group may also contribute to its hydrophobic characteristics, affecting solubility and membrane permeability. This compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential applications in drug design and development. Its CAS number, 63407-54-5, allows for easy identification in chemical databases and literature. Overall, 2-phenylethyl 1-thio-beta-D-galactopyranoside exemplifies the complexity and diversity of glycosidic compounds in chemical research.
Formula:C14H20O5S
InChI:InChI=1/C14H20O5S/c15-8-10-11(16)12(17)13(18)14(19-10)20-7-6-9-4-2-1-3-5-9/h1-5,10-18H,6-8H2/t10-,11+,12+,13-,14+/m1/s1
Synonyms:- beta-D-Galactopyranoside, 2-phenylethyl 1-thio-
- 2-Phenylethyl-Beta-D-Thiogalactoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Phenylethyl-β-D-thiogalactopyranoside
CAS:Phenylethyl-β-D-thiogalactopyranosideFormula:C14H20O5SPurity:Nmr: 100% (Typical Value in Batch COA)Color and Shape:SolidMolecular weight:300.37062-Phenylethyl-β-D-thiogalactoside
CAS:Formula:C14H20O5SPurity:98%Color and Shape:SolidMolecular weight:300.37062-Phenylethyl 1-Thio-β-D-galactopyranoside
CAS:Formula:C14H20O5SPurity:>98.0%(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:300.37Phenylethyl b-D-thiogalactopyranoside
CAS:?-galactosidase inhibitorFormula:C14H20O5SColor and Shape:PowderMolecular weight:300.37 g/molPhenylethyl-β-D-thiogalactopyranoside
CAS:Phenylethyl-beta-D-thiogalactopyranoside is a chemical compound that is used as a building block in the synthesis of other compounds. It can be used as a reagent to create new products or as an intermediate to produce other compounds. This product has been shown to be useful in reactions involving nucleophilic substitution, oxidation, and reduction. Phenylethyl-beta-D-thiogalactopyranoside is also useful as a scaffold for complex molecules. It can be used in research for its potential applications in pharmaceuticals, agrochemicals, and materials science.Formula:C14H20O5SMolecular weight:300.38 g/mol





