CymitQuimica logo

CAS 634602-84-9

:

1H-Benzimidazole-5-carboxylic acid, 2,3-dihydro-2-oxo-, ethyl ester

Description:
1H-Benzimidazole-5-carboxylic acid, 2,3-dihydro-2-oxo-, ethyl ester, identified by CAS number 634602-84-9, is a chemical compound that features a benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound is characterized by the presence of a carboxylic acid functional group and an ethyl ester moiety, contributing to its solubility and reactivity. The dihydro-2-oxo structure indicates the presence of a saturated ring with a carbonyl group, which can influence its biological activity and chemical reactivity. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The presence of both acidic and ester functionalities suggests potential for further chemical modifications, which can enhance its utility in drug development or as a synthetic intermediate. Overall, this compound's unique structural features position it as a versatile candidate for research in organic synthesis and pharmaceutical applications.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-2-15-9(13)6-3-4-7-8(5-6)12-10(14)11-7/h3-5H,2H2,1H3,(H2,11,12,14)
InChI key:OUTDXJNOFZUMGN-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC2=C(C=C1)NC(=O)N2
Found 3 products.