CAS 636-26-0
:5-methyl-2-thiouracil
Description:
5-Methyl-2-thiouracil is a sulfur-containing derivative of uracil, classified as a pyrimidine nucleobase. It features a methyl group at the 5-position and a thiol group at the 2-position of the uracil ring, which contributes to its unique chemical properties. This compound is typically a white to off-white crystalline solid, and it is soluble in polar solvents such as water and alcohols. 5-Methyl-2-thiouracil is known for its role in biochemical processes, particularly in the inhibition of certain enzymes involved in nucleic acid synthesis, making it of interest in medicinal chemistry and pharmacology. Its structural modifications compared to uracil can affect its biological activity and interactions with nucleic acids. Additionally, it has been studied for its potential applications in cancer treatment and as an antiviral agent. Safety data indicates that, like many chemical substances, it should be handled with care, following appropriate safety protocols to mitigate any health risks associated with exposure.
Formula:C5H6N2OS
InChI:InChI=1/C5H6N2OS/c1-3-2-6-5(9)7-4(3)8/h2H,1H3,(H2,6,7,8,9)
InChI key:InChIKey=ZLAQATDNGLKIEV-UHFFFAOYSA-N
SMILES:O=C1C(C)=CNC(=S)N1
Synonyms:- 2,3-Dihydro-5-methyl-2-thioxo-4(1H)-pyrimidinone
- 2-Thiothymine
- 4(1H)-Pyrimidinone, 2,3-dihydro-5-methyl-2-thioxo-
- 4-Hydroxy-2-mercapto-5-methylpyrimidine
- 4-Hydroxy-5-methyl-2-mercaptopyrimidine
- 4-Hydroxy-5-methylpyrimidine-2-thione
- 5-Methyl-2-thioxo-2,3-dihydro-1H-pyrimidin-4-one
- 5-methyl-2-thioxo-2,3-dihydropyrimidin-4(1H)-one
- NSC 314272
- NSC 9377
- Thiothymine
- Thymine, 2-thio-
- 5-Methyl-2-thiouracil
- 5-Methyl-2-thioxo-2,3-dihydro-4(1H)-pyrimidinone
- 1,2-Dihydro-2-thioxo-5-methylpyrimidine-4(3H)-one
- 2-thio-thymin
- Uracil, 5-methyl-2-thio-
- 2,3-dihydro-5-methyl-2-thioxo-4(1h)-pyrimidinon
- 4-Hydroxy-2-mercapto-5-methylpyrimidine~2-Thiothymine
- 4(1H)-Pyrimidinone, 2,3-dihydro-5-methyl-2-thioxo-(9CI)
- 4-HYDROXY-5-METHYL-2-THIOPYRIMIDINE
- 5-METHYL-2-THIOURACIL 98+%
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4(1H)-Pyrimidinone,2,3-dihydro-5-methyl-2-thioxo-
CAS:Formula:C5H6N2OSPurity:95%Color and Shape:SolidMolecular weight:142.17895-Methyl-2-thiouracil
CAS:5-Methyl-2-thiouracilFormula:C5H6N2OSPurity:98%Color and Shape: white solidMolecular weight:142.18g/mol4-Hydroxy-5-methyl-2-mercaptopyrimidine
CAS:Formula:C5H6N2OSPurity:98%Color and Shape:SolidMolecular weight:142.185-Methyl-2-thiouracil
CAS:Formula:C5H6N2OSPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:142.182-Thiothymine
CAS:<p>2-Thiothymine is a nucleotide that can be synthesized by the polymerase chain reaction. It is used as a probe for determining the sequence of DNA duplexes. 2-Thiothymine binds to dna and forms hydrogen bonds with the nitrogen atoms in dna bases, which prevents them from being able to bind with other dna bases, thereby disrupting the binding of dna strands. This leads to chain reactions that result in high temperatures and could cause damage to the cells. 2-Thiothymine has been shown to be toxic to both bacteria and human cells. It was found to inhibit HIV infection by binding to viral RNA and preventing it from being translated into protein, leading to cell death.</p>Formula:C5H6N2OSPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:142.18 g/molRef: 3D-FT11851
Discontinued product




