CAS 636-61-3: D-Malic acid
Description:D-Malic acid, with the CAS number 636-61-3, is a naturally occurring organic compound classified as a dicarboxylic acid. It is a stereoisomer of malic acid, specifically the D-form, which is less common than its L counterpart. D-Malic acid is a colorless, crystalline solid that is soluble in water and exhibits a slightly tart flavor, making it relevant in food and beverage applications as an acidulant. Its molecular formula is C4H6O5, and it features two carboxyl functional groups (-COOH) that contribute to its acidity and reactivity. D-Malic acid plays a role in various biochemical processes, including the citric acid cycle, and is involved in the metabolism of carbohydrates. In addition to its applications in the food industry, it is also used in cosmetics and pharmaceuticals. The compound is generally recognized as safe when used appropriately, but like many organic acids, it can cause irritation upon direct contact with skin or mucous membranes.
Formula:C4H6O5
InChI:InChI=1S/C4H6O5/c5-2(4(8)9)1-3(6)7/h2,5H,1H2,(H,6,7)(H,8,9)/t2-/m1/s1
InChI key:InChIKey=BJEPYKJPYRNKOW-UWTATZPHSA-N
SMILES:O=C(O)CC(O)C(=O)O
- Synonyms:
- Butanedioic acid, hydroxy-, (R)-
- Butanedioic acid, hydroxy-, (2R)-
- (2R)-2-Hydroxybutanedioic acid
- D-(+)-Malic Acid
- Malic acid, D-
- Butanedioic acid, 2-hydroxy-, (2R)-
