CymitQuimica logo

CAS 636-65-7

:

L-glutamic acid amide

Description:
L-glutamic acid amide, also known as L-glutamine, is an amino acid that plays a crucial role in various biological processes. It is a non-essential amino acid, meaning that the body can synthesize it, and it is vital for protein synthesis, cellular metabolism, and nitrogen transport. L-glutamine is characterized by its amide functional group, which distinguishes it from its parent amino acid, glutamic acid. This compound is soluble in water and exhibits a neutral pH in solution, making it biologically compatible. L-glutamine is particularly important in the metabolism of rapidly dividing cells, such as those in the immune system and the gastrointestinal tract. It also serves as a precursor for the synthesis of nucleotides and neurotransmitters. In addition to its physiological roles, L-glutamine is often used in dietary supplements and clinical nutrition to support recovery and immune function, especially in patients undergoing stress or illness. Its stability and solubility make it a valuable compound in both research and therapeutic applications.
Formula:C5H10N2O3
InChI:InChI=1/C5H10N2O3/c6-3(5(7)10)1-2-4(8)9/h3H,1-2,6H2,(H2,7,10)(H,8,9)/t3-/m0/s1
InChI key:AEFLONBTGZFSGQ-VKHMYHEASA-N
SMILES:C(CC(=O)O)[C@@H](C(=N)O)N
Synonyms:
  • H-Glu-NH2
  • L-alpha-glutamine
  • L-Isoglutamine
Found 9 products.