CAS 636-94-2: 2-hydroxybenzene-1,4-dicarboxylic acid
Description:2-Hydroxybenzene-1,4-dicarboxylic acid, commonly known as gallic acid, is an organic compound characterized by its aromatic structure featuring two carboxylic acid groups and a hydroxyl group. It appears as a white to pale yellow crystalline powder and is soluble in water, alcohol, and ether. This compound exhibits strong antioxidant properties, making it valuable in various applications, including food preservation, pharmaceuticals, and cosmetics. Gallic acid is known for its ability to chelate metal ions and has been studied for its potential health benefits, including anti-inflammatory and antimicrobial effects. Its chemical structure allows it to participate in various chemical reactions, including esterification and oxidation. Additionally, gallic acid is a natural product found in various plants, particularly in gallnuts, tea leaves, and certain fruits, contributing to its role in traditional medicine and dietary supplements. Overall, 2-hydroxybenzene-1,4-dicarboxylic acid is a versatile compound with significant biological and industrial relevance.
Formula:C8H6O5
InChI:InChI=1/C8H6O5/c9-6-3-4(7(10)11)1-2-5(6)8(12)13/h1-3,9H,(H,10,11)(H,12,13)
- Synonyms:
- 1,4-Benzenedicarboxylic Acid, 2-Hydroxy-
- 2-Hydroxyterephthalic acid
- 2-Hydroxybenzene-1,4-dicarboxylic acid
