CAS 63600-35-1
:Aceticacidvinylphenylester
Description:
Acetic acid vinyl phenyl ester, with the CAS number 63600-35-1, is an organic compound that belongs to the class of esters. It is characterized by the presence of both acetic acid and a vinyl phenyl group in its structure, which contributes to its reactivity and potential applications in polymer chemistry. This compound typically appears as a colorless to pale yellow liquid and has a distinctive sweet odor. It is soluble in organic solvents and exhibits moderate stability under standard conditions. Acetic acid vinyl phenyl ester is often used as a monomer in the production of copolymers and resins, particularly in applications requiring adhesion, coatings, and sealants. Its reactivity allows it to participate in various polymerization processes, including free radical polymerization. Safety considerations include handling it in well-ventilated areas and using appropriate personal protective equipment, as it may cause irritation to the skin and eyes. Overall, this compound plays a significant role in the development of advanced materials in the chemical industry.
Formula:C10H10O2
InChI:InChI=1/C10H10O2/c1-3-9-6-4-5-7-10(9)12-8(2)11/h3-7H,1H2,2H3
SMILES:C=Cc1ccccc1OC(=O)C
Synonyms:- Acetic acid 4-vinylphenyl ester
- 2-Ethenylphenyl Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Vinylphenyl Acetate (stabilized with Phenothiazine)
CAS:Formula:C10H10O2Purity:>93.0%(GC)Color and Shape:Colorless to Yellow to Orange clear liquidMolecular weight:162.19Ref: IN-DA003NMN
25gTo inquire100gTo inquire500gTo inquire100mg34.00€250mg62.00€1g118.00€5g211.00€10g336.00€Acetic acid 2-vinylphenyl ester
CAS:Acetic acid 2-vinylphenyl ester
Purity:95%Molecular weight:162.19g/mol2-Vinylphenyl acetate
CAS:2-Vinylphenyl acetateFormula:C10H10O2Purity:93% (stabilized with Phenothiazine)Molecular weight:162.19




