CAS 63626-06-2
:8-(bromoacetyl)-6,8,11-trihydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione
Description:
The chemical substance known as 8-(bromoacetyl)-6,8,11-trihydroxy-1-methoxy-7,8,9,10-tetrahydrotetracene-5,12-dione, with the CAS number 63626-06-2, is a complex organic compound characterized by its tetracene backbone, which is a polycyclic aromatic hydrocarbon. This compound features multiple functional groups, including hydroxyl (-OH) groups and a bromoacetyl moiety, which contribute to its reactivity and potential applications in organic synthesis and materials science. The presence of the methoxy group (-OCH3) enhances its solubility in organic solvents, while the dione structure indicates the presence of two carbonyl groups, which can participate in various chemical reactions. The specific arrangement of these functional groups imparts unique electronic and optical properties, making it of interest in fields such as organic electronics and photonics. Additionally, the compound's structural complexity suggests potential for diverse interactions in biological systems, warranting further investigation into its pharmacological properties.
Formula:C21H17BrO7
InChI:InChI=1/C21H17BrO7/c1-29-12-4-2-3-10-14(12)20(27)16-15(18(10)25)19(26)11-7-21(28,13(23)8-22)6-5-9(11)17(16)24/h2-4,24,26,28H,5-8H2,1H3
SMILES:COc1cccc2c1C(=O)c1c(C2=O)c(c2CC(CCc2c1O)(C(=O)CBr)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Bromo Didehydro Doxorubicinone
CAS:Controlled ProductFormula:C21H17BrO7Color and Shape:NeatMolecular weight:461.26
