CymitQuimica logo

CAS 637031-88-0

:

3,3-Difluorocyclobutanol

Description:
3,3-Difluorocyclobutanol is a fluorinated organic compound characterized by its cyclobutane ring structure, which features two fluorine atoms attached to the same carbon atom in the ring. This substitution significantly influences its chemical properties, including its reactivity and polarity. The presence of the hydroxyl (-OH) group makes it an alcohol, contributing to its potential for hydrogen bonding, which can affect its solubility in polar solvents. The fluorine atoms enhance the compound's stability and can impart unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound's molecular structure allows for potential applications in synthetic chemistry, where it may serve as an intermediate or building block for more complex molecules. Additionally, the presence of fluorine can influence the compound's biological activity, making it a subject of study in medicinal chemistry. Overall, 3,3-Difluorocyclobutanol exhibits a combination of unique physical and chemical characteristics due to its specific molecular structure.
Formula:C4H6F2O
InChI:InChI=1S/C4H6F2O/c5-4(6)1-3(7)2-4/h3,7H,1-2H2
InChI key:InChIKey=BFLCYDVYEGKWSQ-UHFFFAOYSA-N
SMILES:FC1(F)CC(O)C1
Synonyms:
  • 3,3-Difluorocyclobutanol
  • Cyclobutanol, 3,3-difluoro-
  • 3,3-Difluorocyclobutan-1-ol
Found 4 products.