CymitQuimica logo

CAS 637039-01-1

:

6-Oxa-2,9-diazaspiro[4.5]decane-9-carboxylic acid, 1,1-dimethylethylester

Description:
6-Oxa-2,9-diazaspiro[4.5]decane-9-carboxylic acid, 1,1-dimethylethyl ester, identified by CAS number 637039-01-1, is a chemical compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and oxygen heteroatoms. This compound features a bicyclic framework that includes a carboxylic acid moiety, which is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of nitrogen atoms in the diazaspiro structure may impart specific properties such as basicity and the ability to participate in hydrogen bonding. The oxo group contributes to the compound's reactivity and solubility characteristics. Such compounds often exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. However, detailed studies on its specific biological activities, stability, and reactivity would be necessary to fully understand its potential applications. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C12H22N2O3
InChI:InChI=1S/C12H22N2O3/c1-11(2,3)17-10(15)14-6-7-16-12(9-14)4-5-13-8-12/h13H,4-9H2,1-3H3
InChI key:VESCRSHLXRKQFF-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCOC2(C1)CCNC2
Found 5 products.