CymitQuimica logo

CAS 63725-49-5

:

1H-Pyrazolo[3,4-b]pyridin-6-aMine

Description:
1H-Pyrazolo[3,4-b]pyridin-6-amine, with the CAS number 63725-49-5, is a heterocyclic organic compound characterized by its pyrazolo and pyridine ring structures. This compound features a pyrazole ring fused to a pyridine ring, with an amino group (-NH2) located at the 6-position of the pyridine moiety. It is typically a solid at room temperature and may exhibit properties such as moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The compound is of interest in medicinal chemistry and drug development, as derivatives of pyrazolo-pyridines have been studied for their potential biological activities, including anti-inflammatory and anticancer properties. Its reactivity can be influenced by the functional groups present, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C6H6N4
InChI:InChI=1S/C6H6N4/c7-5-2-1-4-3-8-10-6(4)9-5/h1-3H,(H3,7,8,9,10)
InChI key:XOXOWZFVBMJORH-UHFFFAOYSA-N
SMILES:C1=CC(=NC2=C1C=NN2)N
Found 5 products.