CymitQuimica logo

CAS 63734-62-3

:

3-[2-Chloro-4-(trifluoromethyl)phenoxy]benzoic acid

Description:
3-[2-Chloro-4-(trifluoromethyl)phenoxy]benzoic acid, with the CAS number 63734-62-3, is a chemical compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which contributes to its acidity and potential reactivity. The presence of a chloro group and a trifluoromethyl group on the phenoxy ring enhances its lipophilicity and may influence its biological activity. This compound is typically used in research and development, particularly in the fields of agrochemicals and pharmaceuticals, due to its potential as a herbicide or as an intermediate in the synthesis of other chemical entities. Its physical properties, such as solubility and melting point, can vary based on environmental conditions and purity. Additionally, the presence of halogen substituents often affects the compound's stability and reactivity, making it of interest in various chemical applications. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks.
Formula:C14H8ClF3O3
InChI:InChI=1S/C14H8ClF3O3/c15-11-7-9(14(16,17)18)4-5-12(11)21-10-3-1-2-8(6-10)13(19)20/h1-7H,(H,19,20)
InChI key:InChIKey=ONKRUAQFUNKYAX-UHFFFAOYSA-N
SMILES:O(C1=C(Cl)C=C(C(F)(F)F)C=C1)C2=CC(C(O)=O)=CC=C2
Synonyms:
  • 264-433-9
  • 3-[(2-Chloro-α,α,α-trifluoro-4-tolyl)oxy]benzoic acid
  • 3-[2-Chloro-4-(trifluoromethyl)phenoxy]benzoic acid
  • Benzoic Acid, 3-[2-Chloro-4-(Trifluoromethyl)Phenoxy]-
  • 3-(2-Chloro-4-trifluoromethylphenoxy)benzoic acid
Found 3 products.